C9H15N3O — CID 19281043
1-ethyl-N-propan-2-ylpyrazole-4-carboxamide (PubChem CID 19281043) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-ethyl-N-propan-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-ethyl-N-propan-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19281043 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 1-ethyl-N-propan-2-ylpyrazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)NC(C)C)cn1 |
| InChI | InChI=1S/C9H15N3O/c1-4-12-6-8(5-10-12)9(13)11-7(2)3/h5-7H,4H2,1-3H3,(H,11,13) |
| InChIKey | MDCPBCQLTPGIQR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |