C14H25N3O — CID 75523998
N,N-di(butan-2-yl)-1-ethylpyrazole-4-carboxamide (PubChem CID 75523998) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is N,N-di(butan-2-yl)-1-ethylpyrazole-4-carboxamide.
| Compound Name | N,N-di(butan-2-yl)-1-ethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 75523998 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | N,N-di(butan-2-yl)-1-ethylpyrazole-4-carboxamide |
| SMILES | CCC(C)N(C(=O)c1cnn(CC)c1)C(C)CC |
| InChI | InChI=1S/C14H25N3O/c1-6-11(4)17(12(5)7-2)14(18)13-9-15-16(8-3)10-13/h9-12H,6-8H2,1-5H3 |
| InChIKey | PQMWNHZSANQVJG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |