C23H22N4O5 — CID 19281973
N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide (PubChem CID 19281973) has the molecular formula C23H22N4O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide.
| Compound Name | N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19281973 |
| Molecular Formula | C23H22N4O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide |
| SMILES | Cc1nn(CCNC(=O)c2ccc(COc3ccc4ccccc4c3)o2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H22N4O5/c1-15-22(27(29)30)16(2)26(25-15)12-11-24-23(28)21-10-9-20(32-21)14-31-19-8-7-17-5-3-4-6-18(17)13-19/h3-10,13H,11-12,14H2,1-2H3,(H,24,28) |
| InChIKey | YYAUWFSSADCXRG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|