C18H17N5O7 — CID 19283093
N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-5-[(4-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19283093) has the molecular formula C18H17N5O7 and a molecular weight of 415.36 g/mol. Its IUPAC name is N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-5-[(4-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-5-[(4-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19283093 |
| Molecular Formula | C18H17N5O7 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-5-[(4-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1CCNC(=O)c1ccc(COc2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C18H17N5O7/c1-12-10-17(23(27)28)20-21(12)9-8-19-18(24)16-7-6-15(30-16)11-29-14-4-2-13(3-5-14)22(25)26/h2-7,10H,8-9,11H2,1H3,(H,19,24) |
| InChIKey | NYHMWWAHUGQLCS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 155.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|