C23H30ClN7O5 — CID 19282037
2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]acetamide (PubChem CID 19282037) has the molecular formula C23H30ClN7O5 and a molecular weight of 519.99 g/mol. Its IUPAC name is 2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]acetamide.
| Compound Name | 2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 19282037 |
| Molecular Formula | C23H30ClN7O5 |
| Molecular Weight | 519.99 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]acetamide |
| SMILES | Cc1nn(CCNC(=O)CC23CC4CC(C2)CC(n2nc([N+](=O)[O-])c(Cl)c2C)(C4)C3)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H30ClN7O5/c1-13-20(30(33)34)15(3)28(26-13)5-4-25-18(32)11-22-7-16-6-17(8-22)10-23(9-16,12-22)29-14(2)19(24)21(27-29)31(35)36/h16-17H,4-12H2,1-3H3,(H,25,32) |
| InChIKey | YLFRJWPMJALJGC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 151.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.99 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|