C21H27N7O5 — CID 19283136
N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide (PubChem CID 19283136) has the molecular formula C21H27N7O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide.
| Compound Name | N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 19283136 |
| Molecular Formula | C21H27N7O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1CCNC(=O)CC12CC3CC(C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2 |
| InChI | InChI=1S/C21H27N7O5/c1-14-4-18(28(32)33)24-25(14)3-2-22-19(29)10-20-6-15-5-16(7-20)9-21(8-15,13-20)26-12-17(11-23-26)27(30)31/h4,11-12,15-16H,2-3,5-10,13H2,1H3,(H,22,29) |
| InChIKey | RDVRQGOKBSTBHH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 151.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|