C17H16Cl2N6O4 — CID 19283215
1-[(2,3-dichlorophenoxy)methyl]-N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]pyrazole-3-carboxamide (PubChem CID 19283215) has the molecular formula C17H16Cl2N6O4 and a molecular weight of 439.26 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenoxy)methyl]-N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(2,3-dichlorophenoxy)methyl]-N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19283215 |
| Molecular Formula | C17H16Cl2N6O4 |
| Molecular Weight | 439.26 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 1-[(2,3-dichlorophenoxy)methyl]-N-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1CCNC(=O)c1ccn(COc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C17H16Cl2N6O4/c1-11-9-15(25(27)28)22-24(11)8-6-20-17(26)13-5-7-23(21-13)10-29-14-4-2-3-12(18)16(14)19/h2-5,7,9H,6,8,10H2,1H3,(H,20,26) |
| InChIKey | KCUWHIIFMIDUTO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|