C13H14ClN5O3 — CID 19283635
1-(3-chlorophenyl)-3-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]urea (PubChem CID 19283635) has the molecular formula C13H14ClN5O3 and a molecular weight of 323.74 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 19283635 |
| Molecular Formula | C13H14ClN5O3 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]urea |
| SMILES | Cc1cc([N+](=O)[O-])nn1CCNC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H14ClN5O3/c1-9-7-12(19(21)22)17-18(9)6-5-15-13(20)16-11-4-2-3-10(14)8-11/h2-4,7-8H,5-6H2,1H3,(H2,15,16,20) |
| InChIKey | VGKMUOXOOHYEKO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|