C14H14N2O4 — CID 19288930
1-(2-imino-6-nitrochromen-3-yl)-2,2-dimethylpropan-1-one (PubChem CID 19288930) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-(2-imino-6-nitrochromen-3-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(2-imino-6-nitrochromen-3-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 19288930 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(2-imino-6-nitrochromen-3-yl)-2,2-dimethylpropan-1-one |
| SMILES | [H]/N=c1\oc2ccc([N+](=O)[O-])cc2cc1C(=O)C(C)(C)C |
| InChI | InChI=1S/C14H14N2O4/c1-14(2,3)12(17)10-7-8-6-9(16(18)19)4-5-11(8)20-13(10)15/h4-7,15H,1-3H3/b15-13- |
| InChIKey | HVUJGTLFBLQLGR-SQFISAMPSA-N |
| XLogP | 3.05 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|