C16H22F3N3OS — CID 19291482
N-(2-methoxyethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine-1-carbothioamide (PubChem CID 19291482) has the molecular formula C16H22F3N3OS and a molecular weight of 361.43 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine-1-carbothioamide.
| Compound Name | N-(2-methoxyethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19291482 |
| Molecular Formula | C16H22F3N3OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-(2-methoxyethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine-1-carbothioamide |
| SMILES | COCCNC(=S)N1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H22F3N3OS/c1-23-10-5-20-15(24)22-8-6-21(7-9-22)12-13-3-2-4-14(11-13)16(17,18)19/h2-4,11H,5-10,12H2,1H3,(H,20,24) |
| InChIKey | UTGXOOSDWRWGFB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|