C15H16ClFN4O2 — CID 19291905
[(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(4-chloro-3,5-dimethylpyrazol-1-yl)propanoate (PubChem CID 19291905) has the molecular formula C15H16ClFN4O2 and a molecular weight of 338.77 g/mol. Its IUPAC name is [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(4-chloro-3,5-dimethylpyrazol-1-yl)propanoate.
| Compound Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(4-chloro-3,5-dimethylpyrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 19291905 |
| Molecular Formula | C15H16ClFN4O2 |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(4-chloro-3,5-dimethylpyrazol-1-yl)propanoate |
| SMILES | Cc1nn(CCC(=O)O/N=C(\N)c2ccc(F)cc2)c(C)c1Cl |
| InChI | InChI=1S/C15H16ClFN4O2/c1-9-14(16)10(2)21(19-9)8-7-13(22)23-20-15(18)11-3-5-12(17)6-4-11/h3-6H,7-8H2,1-2H3,(H2,18,20) |
| InChIKey | WZPPOVJTEBZLOO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|