C19H15F4N3O2 — CID 19292392
N-[(1-methylpyrazol-4-yl)methyl]-4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzamide (PubChem CID 19292392) has the molecular formula C19H15F4N3O2 and a molecular weight of 393.34 g/mol. Its IUPAC name is N-[(1-methylpyrazol-4-yl)methyl]-4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzamide.
| Compound Name | N-[(1-methylpyrazol-4-yl)methyl]-4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 19292392 |
| Molecular Formula | C19H15F4N3O2 |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[(1-methylpyrazol-4-yl)methyl]-4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzamide |
| SMILES | Cn1cc(CNC(=O)c2ccc(COc3c(F)c(F)cc(F)c3F)cc2)cn1 |
| InChI | InChI=1S/C19H15F4N3O2/c1-26-9-12(8-25-26)7-24-19(27)13-4-2-11(3-5-13)10-28-18-16(22)14(20)6-15(21)17(18)23/h2-6,8-9H,7,10H2,1H3,(H,24,27) |
| InChIKey | ZTINKPJWKRYJTL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|