C26H19Cl2F6N5O — CID 19297003
[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-[5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 19297003) has the molecular formula C26H19Cl2F6N5O and a molecular weight of 602.37 g/mol. Its IUPAC name is [4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-[5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | [4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-[5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 19297003 |
| Molecular Formula | C26H19Cl2F6N5O |
| Molecular Weight | 602.37 g/mol |
| Exact Mass | 601.09 |
| IUPAC Name | [4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-[5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | O=C(c1cc2nc(-c3ccc(F)cc3)cc(C(F)(F)C(F)(F)F)n2n1)N1CCN(Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C26H19Cl2F6N5O/c27-17-4-1-16(19(28)11-17)14-37-7-9-38(10-8-37)24(40)21-13-23-35-20(15-2-5-18(29)6-3-15)12-22(39(23)36-21)25(30,31)26(32,33)34/h1-6,11-13H,7-10,14H2 |
| InChIKey | CPQBCKALZQAEEL-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.37 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|