C31H27F6N7O — CID 19331791
[4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]-[5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 19331791) has the molecular formula C31H27F6N7O and a molecular weight of 627.59 g/mol. Its IUPAC name is [4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]-[5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | [4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]-[5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 19331791 |
| Molecular Formula | C31H27F6N7O |
| Molecular Weight | 627.59 g/mol |
| Exact Mass | 627.22 |
| IUPAC Name | [4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]-[5-(4-fluorophenyl)-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CN1CCN(C(=O)c2cc3nc(-c4ccc(F)cc4)cc(C(F)(F)C(F)(F)F)n3n2)CC1 |
| InChI | InChI=1S/C31H27F6N7O/c1-19-24(20(2)43(39-19)23-6-4-3-5-7-23)18-41-12-14-42(15-13-41)29(45)26-17-28-38-25(21-8-10-22(32)11-9-21)16-27(44(28)40-26)30(33,34)31(35,36)37/h3-11,16-17H,12-15,18H2,1-2H3 |
| InChIKey | KLPJJQDVTVDORJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 71.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.59 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|