C46H35N5O6S2 — CID 19304434
N-[(Z)-3-[3-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19304434) has the molecular formula C46H35N5O6S2 and a molecular weight of 817.95 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19304434 |
| Molecular Formula | C46H35N5O6S2 |
| Molecular Weight | 817.95 g/mol |
| Exact Mass | 817.20 |
| IUPAC Name | N-[(Z)-3-[3-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)c2ccccc2)c1)/C(=C/c1ccc(OCc2ccccc2)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C46H35N5O6S2/c52-43(34-16-8-3-9-17-34)48-40(26-31-22-24-38(25-23-31)57-29-32-12-4-1-5-13-32)44(53)47-36-19-11-21-39(28-36)59-42(33-14-6-2-7-15-33)45(54)50-46-49-41(30-58-46)35-18-10-20-37(27-35)51(55)56/h1-28,30,42H,29H2,(H,47,53)(H,48,52)(H,49,50,54)/b40-26- |
| InChIKey | PGSDMOONGIUINV-JDQUBRHVSA-N |
| XLogP | 10.18 |
| TPSA | 152.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.95 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|