C28H22BrN3O3S2 — CID 19312006
N-[(Z)-3-[3-[2-(2-bromoanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19312006) has the molecular formula C28H22BrN3O3S2 and a molecular weight of 592.54 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(2-bromoanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(2-bromoanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312006 |
| Molecular Formula | C28H22BrN3O3S2 |
| Molecular Weight | 592.54 g/mol |
| Exact Mass | 591.03 |
| IUPAC Name | N-[(Z)-3-[3-[2-(2-bromoanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C/c2ccsc2)NC(=O)c2ccccc2)c1)Nc1ccccc1Br |
| InChI | InChI=1S/C28H22BrN3O3S2/c29-23-11-4-5-12-24(23)31-26(33)18-37-22-10-6-9-21(16-22)30-28(35)25(15-19-13-14-36-17-19)32-27(34)20-7-2-1-3-8-20/h1-17H,18H2,(H,30,35)(H,31,33)(H,32,34)/b25-15- |
| InChIKey | VJAQRSLWEAWCPA-MYYYXRDXSA-N |
| XLogP | 6.65 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.54 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|