C30H27ClN2O2S — CID 19318663
2-[3-[[2-(4-chlorophenyl)acetyl]amino]phenyl]sulfanyl-N,N-diphenylbutanamide (PubChem CID 19318663) has the molecular formula C30H27ClN2O2S and a molecular weight of 515.08 g/mol. Its IUPAC name is 2-[3-[[2-(4-chlorophenyl)acetyl]amino]phenyl]sulfanyl-N,N-diphenylbutanamide.
| Compound Name | 2-[3-[[2-(4-chlorophenyl)acetyl]amino]phenyl]sulfanyl-N,N-diphenylbutanamide |
|---|---|
| PubChem CID | 19318663 |
| Molecular Formula | C30H27ClN2O2S |
| Molecular Weight | 515.08 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 2-[3-[[2-(4-chlorophenyl)acetyl]amino]phenyl]sulfanyl-N,N-diphenylbutanamide |
| SMILES | CCC(Sc1cccc(NC(=O)Cc2ccc(Cl)cc2)c1)C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H27ClN2O2S/c1-2-28(30(35)33(25-11-5-3-6-12-25)26-13-7-4-8-14-26)36-27-15-9-10-24(21-27)32-29(34)20-22-16-18-23(31)19-17-22/h3-19,21,28H,2,20H2,1H3,(H,32,34) |
| InChIKey | JAAMZCTVFCUKAB-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.08 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |