C35H27ClN4O3S — CID 19319147
N-[(Z)-1-(3-chlorophenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19319147) has the molecular formula C35H27ClN4O3S and a molecular weight of 619.15 g/mol. Its IUPAC name is N-[(Z)-1-(3-chlorophenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3-chlorophenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19319147 |
| Molecular Formula | C35H27ClN4O3S |
| Molecular Weight | 619.15 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | N-[(Z)-1-(3-chlorophenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2ccccn2)c2ccccc2)c1)/C(=C/c1cccc(Cl)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H27ClN4O3S/c36-27-16-9-11-24(21-27)22-30(39-33(41)26-14-5-2-6-15-26)34(42)38-28-17-10-18-29(23-28)44-32(25-12-3-1-4-13-25)35(43)40-31-19-7-8-20-37-31/h1-23,32H,(H,38,42)(H,39,41)(H,37,40,43)/b30-22- |
| InChIKey | PWKYREFIACCIRH-SWKFRHMKSA-N |
| XLogP | 7.62 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.15 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|