C24H24ClN3O5 — CID 19323639
[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-yl]methanone (PubChem CID 19323639) has the molecular formula C24H24ClN3O5 and a molecular weight of 469.93 g/mol. Its IUPAC name is [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-yl]methanone.
| Compound Name | [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 19323639 |
| Molecular Formula | C24H24ClN3O5 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-yl]methanone |
| SMILES | Cc1cc(OCc2ccc(C(=O)N3CCN(Cc4cccc(Cl)c4)CC3)o2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H24ClN3O5/c1-17-13-20(5-7-22(17)28(30)31)32-16-21-6-8-23(33-21)24(29)27-11-9-26(10-12-27)15-18-3-2-4-19(25)14-18/h2-8,13-14H,9-12,15-16H2,1H3 |
| InChIKey | JIALKNOBQJDOCL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 89.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|