C26H27ClN2O3 — CID 19323614
[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-yl]methanone (PubChem CID 19323614) has the molecular formula C26H27ClN2O3 and a molecular weight of 450.97 g/mol. Its IUPAC name is [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-yl]methanone.
| Compound Name | [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 19323614 |
| Molecular Formula | C26H27ClN2O3 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-yl]methanone |
| SMILES | C=CCc1ccccc1OCc1ccc(C(=O)N2CCN(Cc3cccc(Cl)c3)CC2)o1 |
| InChI | InChI=1S/C26H27ClN2O3/c1-2-6-21-8-3-4-10-24(21)31-19-23-11-12-25(32-23)26(30)29-15-13-28(14-16-29)18-20-7-5-9-22(27)17-20/h2-5,7-12,17H,1,6,13-16,18-19H2 |
| InChIKey | PWRDYTCUESLNJV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|