C25H25ClN2O3 — CID 95754485
[4-(4-chlorophenyl)piperazin-1-yl]-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-yl]methanone (PubChem CID 95754485) has the molecular formula C25H25ClN2O3 and a molecular weight of 436.94 g/mol. Its IUPAC name is [4-(4-chlorophenyl)piperazin-1-yl]-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-yl]methanone.
| Compound Name | [4-(4-chlorophenyl)piperazin-1-yl]-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 95754485 |
| Molecular Formula | C25H25ClN2O3 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [4-(4-chlorophenyl)piperazin-1-yl]-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-yl]methanone |
| SMILES | C=CCc1ccccc1OCc1ccc(C(=O)N2CCN(c3ccc(Cl)cc3)CC2)o1 |
| InChI | InChI=1S/C25H25ClN2O3/c1-2-5-19-6-3-4-7-23(19)30-18-22-12-13-24(31-22)25(29)28-16-14-27(15-17-28)21-10-8-20(26)9-11-21/h2-4,6-13H,1,5,14-18H2 |
| InChIKey | OSSDUJGRKZSQKL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|