C27H30N2O3 — CID 19325286
[4-[(3-methylphenyl)methyl]piperazin-1-yl]-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-yl]methanone (PubChem CID 19325286) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is [4-[(3-methylphenyl)methyl]piperazin-1-yl]-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-yl]methanone.
| Compound Name | [4-[(3-methylphenyl)methyl]piperazin-1-yl]-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 19325286 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | [4-[(3-methylphenyl)methyl]piperazin-1-yl]-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-yl]methanone |
| SMILES | C=CCc1ccccc1OCc1ccc(C(=O)N2CCN(Cc3cccc(C)c3)CC2)o1 |
| InChI | InChI=1S/C27H30N2O3/c1-3-7-23-10-4-5-11-25(23)31-20-24-12-13-26(32-24)27(30)29-16-14-28(15-17-29)19-22-9-6-8-21(2)18-22/h3-6,8-13,18H,1,7,14-17,19-20H2,2H3 |
| InChIKey | QZUXVEIAASSVBU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|