C25H32N2O5 — CID 95752559
tert-butyl 4-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]-1,4-diazepane-1-carboxylate (PubChem CID 95752559) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is tert-butyl 4-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 95752559 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | tert-butyl 4-[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]-1,4-diazepane-1-carboxylate |
| SMILES | C=CCc1ccccc1OCc1ccc(C(=O)N2CCCN(C(=O)OC(C)(C)C)CC2)o1 |
| InChI | InChI=1S/C25H32N2O5/c1-5-9-19-10-6-7-11-21(19)30-18-20-12-13-22(31-20)23(28)26-14-8-15-27(17-16-26)24(29)32-25(2,3)4/h5-7,10-13H,1,8-9,14-18H2,2-4H3 |
| InChIKey | CFEBIFUSGUNVLQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|