C17H18ClF5N6O3 — CID 19324203
N-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetamide (PubChem CID 19324203) has the molecular formula C17H18ClF5N6O3 and a molecular weight of 484.81 g/mol. Its IUPAC name is N-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetamide.
| Compound Name | N-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 19324203 |
| Molecular Formula | C17H18ClF5N6O3 |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | N-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetamide |
| SMILES | Cc1c([N+](=O)[O-])c(C(F)F)nn1CC(=O)NCCCn1nc(C(F)(F)F)c(Cl)c1C1CC1 |
| InChI | InChI=1S/C17H18ClF5N6O3/c1-8-13(29(31)32)12(16(19)20)25-28(8)7-10(30)24-5-2-6-27-14(9-3-4-9)11(18)15(26-27)17(21,22)23/h9,16H,2-7H2,1H3,(H,24,30) |
| InChIKey | JTJJVPOBLMIPOB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|