C14H12FN5O3 — CID 19326333
3-(4-fluorophenyl)-5-[2-(4-nitropyrazol-1-yl)propan-2-yl]-1,2,4-oxadiazole (PubChem CID 19326333) has the molecular formula C14H12FN5O3 and a molecular weight of 317.28 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-[2-(4-nitropyrazol-1-yl)propan-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(4-fluorophenyl)-5-[2-(4-nitropyrazol-1-yl)propan-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19326333 |
| Molecular Formula | C14H12FN5O3 |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-(4-fluorophenyl)-5-[2-(4-nitropyrazol-1-yl)propan-2-yl]-1,2,4-oxadiazole |
| SMILES | CC(C)(c1nc(-c2ccc(F)cc2)no1)n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C14H12FN5O3/c1-14(2,19-8-11(7-16-19)20(21)22)13-17-12(18-23-13)9-3-5-10(15)6-4-9/h3-8H,1-2H3 |
| InChIKey | HOAAYMZKAOJXON-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|