C10H7N5O8 — CID 12015518
3-(4-methoxyphenyl)-5-(trinitromethyl)-1,2,4-oxadiazole (PubChem CID 12015518) has the molecular formula C10H7N5O8 and a molecular weight of 325.19 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5-(trinitromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-(4-methoxyphenyl)-5-(trinitromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 12015518 |
| Molecular Formula | C10H7N5O8 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 3-(4-methoxyphenyl)-5-(trinitromethyl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2noc(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])n2)cc1 |
| InChI | InChI=1S/C10H7N5O8/c1-22-7-4-2-6(3-5-7)8-11-9(23-12-8)10(13(16)17,14(18)19)15(20)21/h2-5H,1H3 |
| InChIKey | QWTBZETZEURDHR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 177.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|