C15H16ClN3O6 — CID 15422985
ethyl 3-chloro-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-nitrobutanoate (PubChem CID 15422985) has the molecular formula C15H16ClN3O6 and a molecular weight of 369.76 g/mol. Its IUPAC name is ethyl 3-chloro-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-nitrobutanoate.
| Compound Name | ethyl 3-chloro-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-nitrobutanoate |
|---|---|
| PubChem CID | 15422985 |
| Molecular Formula | C15H16ClN3O6 |
| Molecular Weight | 369.76 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | ethyl 3-chloro-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-nitrobutanoate |
| SMILES | CCOC(=O)C(c1nc(-c2ccc(OC)cc2)no1)(C(C)Cl)[N+](=O)[O-] |
| InChI | InChI=1S/C15H16ClN3O6/c1-4-24-14(20)15(9(2)16,19(21)22)13-17-12(18-25-13)10-5-7-11(23-3)8-6-10/h5-9H,4H2,1-3H3 |
| InChIKey | JNZDGVNFRXISDL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 117.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.76 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|