C19H11Cl2N3O5 — CID 19326555
3-(2,4-dichlorophenyl)-5-[5-[(4-nitrophenoxy)methyl]furan-2-yl]-1,2,4-oxadiazole (PubChem CID 19326555) has the molecular formula C19H11Cl2N3O5 and a molecular weight of 432.22 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-5-[5-[(4-nitrophenoxy)methyl]furan-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(2,4-dichlorophenyl)-5-[5-[(4-nitrophenoxy)methyl]furan-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19326555 |
| Molecular Formula | C19H11Cl2N3O5 |
| Molecular Weight | 432.22 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-5-[5-[(4-nitrophenoxy)methyl]furan-2-yl]-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(OCc2ccc(-c3nc(-c4ccc(Cl)cc4Cl)no3)o2)cc1 |
| InChI | InChI=1S/C19H11Cl2N3O5/c20-11-1-7-15(16(21)9-11)18-22-19(29-23-18)17-8-6-14(28-17)10-27-13-4-2-12(3-5-13)24(25)26/h1-9H,10H2 |
| InChIKey | CSSPKGYVKVKZIO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 104.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.22 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|