C20H10ClF5N2O4 — CID 19332642
3-(5-chloro-2-methoxyphenyl)-5-[5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-yl]-1,2,4-oxadiazole (PubChem CID 19332642) has the molecular formula C20H10ClF5N2O4 and a molecular weight of 472.75 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-5-[5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-5-[5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19332642 |
| Molecular Formula | C20H10ClF5N2O4 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.02 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-5-[5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-yl]-1,2,4-oxadiazole |
| SMILES | COc1ccc(Cl)cc1-c1noc(-c2ccc(COc3c(F)c(F)c(F)c(F)c3F)o2)n1 |
| InChI | InChI=1S/C20H10ClF5N2O4/c1-29-11-4-2-8(21)6-10(11)19-27-20(32-28-19)12-5-3-9(31-12)7-30-18-16(25)14(23)13(22)15(24)17(18)26/h2-6H,7H2,1H3 |
| InChIKey | YQCLGGCFQPQOLB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 70.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|