C19H19Cl2N3O4 — CID 19327568
[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]-(4-methoxy-3-nitrophenyl)methanone (PubChem CID 19327568) has the molecular formula C19H19Cl2N3O4 and a molecular weight of 424.28 g/mol. Its IUPAC name is [4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]-(4-methoxy-3-nitrophenyl)methanone.
| Compound Name | [4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]-(4-methoxy-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 19327568 |
| Molecular Formula | C19H19Cl2N3O4 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | [4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]-(4-methoxy-3-nitrophenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCN(Cc3c(Cl)cccc3Cl)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19Cl2N3O4/c1-28-18-6-5-13(11-17(18)24(26)27)19(25)23-9-7-22(8-10-23)12-14-15(20)3-2-4-16(14)21/h2-6,11H,7-10,12H2,1H3 |
| InChIKey | BTJWARLAFGTNLU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|