C14H19N5O — CID 19329117
(E)-N-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(1-ethylpyrazol-4-yl)prop-2-enamide (PubChem CID 19329117) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is (E)-N-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(1-ethylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(1-ethylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 19329117 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | (E)-N-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(1-ethylpyrazol-4-yl)prop-2-enamide |
| SMILES | CCn1cc(/C=C/C(=O)NCc2cc(C)n(C)n2)cn1 |
| InChI | InChI=1S/C14H19N5O/c1-4-19-10-12(8-16-19)5-6-14(20)15-9-13-7-11(2)18(3)17-13/h5-8,10H,4,9H2,1-3H3,(H,15,20)/b6-5+ |
| InChIKey | HQPNKBPWAWBVDF-AATRIKPKSA-N |
| XLogP | 1.27 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|