C16H23N5O — CID 19466719
(E)-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-3-(1-ethylpyrazol-4-yl)prop-2-enamide (PubChem CID 19466719) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is (E)-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-3-(1-ethylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-3-(1-ethylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 19466719 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | (E)-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-3-(1-ethylpyrazol-4-yl)prop-2-enamide |
| SMILES | CCn1cc(/C=C/C(=O)NC(C)c2cn(CC)nc2C)cn1 |
| InChI | InChI=1S/C16H23N5O/c1-5-20-10-14(9-17-20)7-8-16(22)18-12(3)15-11-21(6-2)19-13(15)4/h7-12H,5-6H2,1-4H3,(H,18,22)/b8-7+ |
| InChIKey | UXJUXRQCZPTIJI-BQYQJAHWSA-N |
| XLogP | 2.32 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|