C14H20BrN5O — CID 19476696
4-bromo-1-ethyl-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]pyrazole-5-carboxamide (PubChem CID 19476696) has the molecular formula C14H20BrN5O and a molecular weight of 354.25 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]pyrazole-5-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19476696 |
| Molecular Formula | C14H20BrN5O |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 4-bromo-1-ethyl-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]pyrazole-5-carboxamide |
| SMILES | CCn1cc(C(C)NC(=O)c2c(Br)cnn2CC)c(C)n1 |
| InChI | InChI=1S/C14H20BrN5O/c1-5-19-8-11(10(4)18-19)9(3)17-14(21)13-12(15)7-16-20(13)6-2/h7-9H,5-6H2,1-4H3,(H,17,21) |
| InChIKey | PZYCWXYUDKHJFU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |