C13H18IN5O — CID 19476128
N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-4-iodo-1-methylpyrazole-5-carboxamide (PubChem CID 19476128) has the molecular formula C13H18IN5O and a molecular weight of 387.23 g/mol. Its IUPAC name is N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-4-iodo-1-methylpyrazole-5-carboxamide.
| Compound Name | N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-4-iodo-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19476128 |
| Molecular Formula | C13H18IN5O |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-4-iodo-1-methylpyrazole-5-carboxamide |
| SMILES | CCn1cc(C(C)NC(=O)c2c(I)cnn2C)c(C)n1 |
| InChI | InChI=1S/C13H18IN5O/c1-5-19-7-10(9(3)17-19)8(2)16-13(20)12-11(14)6-15-18(12)4/h6-8H,5H2,1-4H3,(H,16,20) |
| InChIKey | GNLUSCYACMNUQS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|