C13H18BrN5O — CID 19475122
4-bromo-N-[1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]-1-methylpyrazole-5-carboxamide (PubChem CID 19475122) has the molecular formula C13H18BrN5O and a molecular weight of 340.23 g/mol. Its IUPAC name is 4-bromo-N-[1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-bromo-N-[1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19475122 |
| Molecular Formula | C13H18BrN5O |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 4-bromo-N-[1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]-1-methylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(C(C)NC(=O)c2c(Br)cnn2C)c1C |
| InChI | InChI=1S/C13H18BrN5O/c1-5-19-9(3)10(6-16-19)8(2)17-13(20)12-11(14)7-15-18(12)4/h6-8H,5H2,1-4H3,(H,17,20) |
| InChIKey | XPJDRFGMRRRILW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |