C21H21Cl2N3O2 — CID 19332939
N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-[(4-chloro-2-methylphenoxy)methyl]benzamide (PubChem CID 19332939) has the molecular formula C21H21Cl2N3O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-[(4-chloro-2-methylphenoxy)methyl]benzamide.
| Compound Name | N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-[(4-chloro-2-methylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 19332939 |
| Molecular Formula | C21H21Cl2N3O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-[(4-chloro-2-methylphenoxy)methyl]benzamide |
| SMILES | CCn1cc(Cl)c(CNC(=O)c2cccc(COc3ccc(Cl)cc3C)c2)n1 |
| InChI | InChI=1S/C21H21Cl2N3O2/c1-3-26-12-18(23)19(25-26)11-24-21(27)16-6-4-5-15(10-16)13-28-20-8-7-17(22)9-14(20)2/h4-10,12H,3,11,13H2,1-2H3,(H,24,27) |
| InChIKey | XDTQHTFEYIWBPK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |