C13H13ClFN3O — CID 19331292
N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-fluorobenzamide (PubChem CID 19331292) has the molecular formula C13H13ClFN3O and a molecular weight of 281.72 g/mol. Its IUPAC name is N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-fluorobenzamide.
| Compound Name | N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 19331292 |
| Molecular Formula | C13H13ClFN3O |
| Molecular Weight | 281.72 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-fluorobenzamide |
| SMILES | CCn1cc(Cl)c(CNC(=O)c2cccc(F)c2)n1 |
| InChI | InChI=1S/C13H13ClFN3O/c1-2-18-8-11(14)12(17-18)7-16-13(19)9-4-3-5-10(15)6-9/h3-6,8H,2,7H2,1H3,(H,16,19) |
| InChIKey | ZUMPTLVZRJCLFQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.72 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |