C23H27BrN4O5S — CID 19333622
[4-[(2-bromophenyl)methyl]piperazin-1-yl]-[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]methanone (PubChem CID 19333622) has the molecular formula C23H27BrN4O5S and a molecular weight of 551.46 g/mol. Its IUPAC name is [4-[(2-bromophenyl)methyl]piperazin-1-yl]-[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]methanone.
| Compound Name | [4-[(2-bromophenyl)methyl]piperazin-1-yl]-[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]methanone |
|---|---|
| PubChem CID | 19333622 |
| Molecular Formula | C23H27BrN4O5S |
| Molecular Weight | 551.46 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | [4-[(2-bromophenyl)methyl]piperazin-1-yl]-[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1)N1CCN(Cc2ccccc2Br)CC1 |
| InChI | InChI=1S/C23H27BrN4O5S/c24-22-4-2-1-3-19(22)17-25-13-15-26(16-14-25)23(29)18-9-11-27(12-10-18)34(32,33)21-7-5-20(6-8-21)28(30)31/h1-8,18H,9-17H2 |
| InChIKey | PKWCHDJXXVJXFU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|