C16H15N7O4S — CID 19334913
methyl 12-methyl-4-[2-(4-nitropyrazol-1-yl)propan-2-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate (PubChem CID 19334913) has the molecular formula C16H15N7O4S and a molecular weight of 401.41 g/mol. Its IUPAC name is methyl 12-methyl-4-[2-(4-nitropyrazol-1-yl)propan-2-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate.
| Compound Name | methyl 12-methyl-4-[2-(4-nitropyrazol-1-yl)propan-2-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate |
|---|---|
| PubChem CID | 19334913 |
| Molecular Formula | C16H15N7O4S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | methyl 12-methyl-4-[2-(4-nitropyrazol-1-yl)propan-2-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate |
| SMILES | COC(=O)c1sc2ncn3nc(C(C)(C)n4cc([N+](=O)[O-])cn4)nc3c2c1C |
| InChI | InChI=1S/C16H15N7O4S/c1-8-10-12-19-15(16(2,3)22-6-9(5-18-22)23(25)26)20-21(12)7-17-13(10)28-11(8)14(24)27-4/h5-7H,1-4H3 |
| InChIKey | WMTVIBXRISEIEB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 130.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|