C17H18N8O4S — CID 19334954
4-[1-(3-methoxy-4-nitropyrazol-1-yl)ethyl]-N,N,12-trimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide (PubChem CID 19334954) has the molecular formula C17H18N8O4S and a molecular weight of 430.45 g/mol. Its IUPAC name is 4-[1-(3-methoxy-4-nitropyrazol-1-yl)ethyl]-N,N,12-trimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide.
| Compound Name | 4-[1-(3-methoxy-4-nitropyrazol-1-yl)ethyl]-N,N,12-trimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide |
|---|---|
| PubChem CID | 19334954 |
| Molecular Formula | C17H18N8O4S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-[1-(3-methoxy-4-nitropyrazol-1-yl)ethyl]-N,N,12-trimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide |
| SMILES | COc1nn(C(C)c2nc3c4c(C)c(C(=O)N(C)C)sc4ncn3n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N8O4S/c1-8-11-14-19-13(9(2)23-6-10(25(27)28)15(21-23)29-5)20-24(14)7-18-16(11)30-12(8)17(26)22(3)4/h6-7,9H,1-5H3 |
| InChIKey | LBKTYBAGJHVXIY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 133.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|