C16H16N8O3S — CID 19334952
4-(1,3-dimethyl-4-nitropyrazol-5-yl)-N,N,12-trimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide (PubChem CID 19334952) has the molecular formula C16H16N8O3S and a molecular weight of 400.42 g/mol. Its IUPAC name is 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-N,N,12-trimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide.
| Compound Name | 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-N,N,12-trimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide |
|---|---|
| PubChem CID | 19334952 |
| Molecular Formula | C16H16N8O3S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-N,N,12-trimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxamide |
| SMILES | Cc1nn(C)c(-c2nc3c4c(C)c(C(=O)N(C)C)sc4ncn3n2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N8O3S/c1-7-9-14-18-13(11-10(24(26)27)8(2)19-22(11)5)20-23(14)6-17-15(9)28-12(7)16(25)21(3)4/h6H,1-5H3 |
| InChIKey | ZJJZKWHPJHRGBN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 124.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|