C19H21N5O5 — CID 19338834
(E)-N-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 19338834) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is (E)-N-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19338834 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (E)-N-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | CCn1ncc(NC(=O)/C=C/c2cccc([N+](=O)[O-])c2)c1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H21N5O5/c1-2-23-18(19(26)22-8-10-29-11-9-22)16(13-20-23)21-17(25)7-6-14-4-3-5-15(12-14)24(27)28/h3-7,12-13H,2,8-11H2,1H3,(H,21,25)/b7-6+ |
| InChIKey | LAVAUBMTSDVQRY-VOTSOKGWSA-N |
| XLogP | 1.94 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|