C13H20N4O5S — CID 19342316
methyl 1-methyl-4-[(1-methylsulfonylpiperidine-4-carbonyl)amino]pyrazole-5-carboxylate (PubChem CID 19342316) has the molecular formula C13H20N4O5S and a molecular weight of 344.39 g/mol. Its IUPAC name is methyl 1-methyl-4-[(1-methylsulfonylpiperidine-4-carbonyl)amino]pyrazole-5-carboxylate.
| Compound Name | methyl 1-methyl-4-[(1-methylsulfonylpiperidine-4-carbonyl)amino]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 19342316 |
| Molecular Formula | C13H20N4O5S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | methyl 1-methyl-4-[(1-methylsulfonylpiperidine-4-carbonyl)amino]pyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C2CCN(S(C)(=O)=O)CC2)cnn1C |
| InChI | InChI=1S/C13H20N4O5S/c1-16-11(13(19)22-2)10(8-14-16)15-12(18)9-4-6-17(7-5-9)23(3,20)21/h8-9H,4-7H2,1-3H3,(H,15,18) |
| InChIKey | NRSVEIQMNDQKGP-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |