C21H21F3N4OS — CID 19343731
1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-[(2-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 19343731) has the molecular formula C21H21F3N4OS and a molecular weight of 434.49 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-[(2-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-[(2-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19343731 |
| Molecular Formula | C21H21F3N4OS |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-[2-(difluoromethoxy)-5-methylphenyl]-3-[1-[(2-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | Cc1ccc(OC(F)F)c(NC(=S)Nc2c(C)nn(Cc3ccccc3F)c2C)c1 |
| InChI | InChI=1S/C21H21F3N4OS/c1-12-8-9-18(29-20(23)24)17(10-12)25-21(30)26-19-13(2)27-28(14(19)3)11-15-6-4-5-7-16(15)22/h4-10,20H,11H2,1-3H3,(H2,25,26,30) |
| InChIKey | PVQGGKCYCQYHLH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|