C19H18BrCl2N5O — CID 19345207
(E)-N-[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-ethyl-5-methylpyrazol-4-yl)prop-2-enamide (PubChem CID 19345207) has the molecular formula C19H18BrCl2N5O and a molecular weight of 483.20 g/mol. Its IUPAC name is (E)-N-[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-ethyl-5-methylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-ethyl-5-methylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 19345207 |
| Molecular Formula | C19H18BrCl2N5O |
| Molecular Weight | 483.20 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | (E)-N-[4-bromo-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1-ethyl-5-methylpyrazol-4-yl)prop-2-enamide |
| SMILES | CCn1ncc(/C=C/C(=O)Nc2nn(Cc3ccc(Cl)c(Cl)c3)cc2Br)c1C |
| InChI | InChI=1S/C19H18BrCl2N5O/c1-3-27-12(2)14(9-23-27)5-7-18(28)24-19-15(20)11-26(25-19)10-13-4-6-16(21)17(22)8-13/h4-9,11H,3,10H2,1-2H3,(H,24,25,28)/b7-5+ |
| InChIKey | GXKHFEYGIPIHAO-FNORWQNLSA-N |
| XLogP | 5.18 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.20 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|