C19H19BrFN5O — CID 19287715
(E)-N-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(1-ethyl-5-methylpyrazol-4-yl)prop-2-enamide (PubChem CID 19287715) has the molecular formula C19H19BrFN5O and a molecular weight of 432.30 g/mol. Its IUPAC name is (E)-N-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(1-ethyl-5-methylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(1-ethyl-5-methylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 19287715 |
| Molecular Formula | C19H19BrFN5O |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | (E)-N-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(1-ethyl-5-methylpyrazol-4-yl)prop-2-enamide |
| SMILES | CCn1ncc(/C=C/C(=O)Nc2nn(Cc3ccccc3F)cc2Br)c1C |
| InChI | InChI=1S/C19H19BrFN5O/c1-3-26-13(2)14(10-22-26)8-9-18(27)23-19-16(20)12-25(24-19)11-15-6-4-5-7-17(15)21/h4-10,12H,3,11H2,1-2H3,(H,23,24,27)/b9-8+ |
| InChIKey | XTAKTXFYKFEGRK-CMDGGOBGSA-N |
| XLogP | 4.01 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|