C14H8Cl2F7N3O — CID 19345385
N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 19345385) has the molecular formula C14H8Cl2F7N3O and a molecular weight of 438.13 g/mol. Its IUPAC name is N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 19345385 |
| Molecular Formula | C14H8Cl2F7N3O |
| Molecular Weight | 438.13 g/mol |
| Exact Mass | 436.99 |
| IUPAC Name | N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | O=C(Nc1ccn(Cc2ccc(Cl)cc2Cl)n1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H8Cl2F7N3O/c15-8-2-1-7(9(16)5-8)6-26-4-3-10(25-26)24-11(27)12(17,18)13(19,20)14(21,22)23/h1-5H,6H2,(H,24,25,27) |
| InChIKey | BVAKGXJAXMDJHC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.13 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|