C15H13BrFN5O — CID 19347187
N-[4-bromo-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-1-methylpyrazole-4-carboxamide (PubChem CID 19347187) has the molecular formula C15H13BrFN5O and a molecular weight of 378.21 g/mol. Its IUPAC name is N-[4-bromo-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[4-bromo-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19347187 |
| Molecular Formula | C15H13BrFN5O |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | N-[4-bromo-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2nn(Cc3ccc(F)cc3)cc2Br)cn1 |
| InChI | InChI=1S/C15H13BrFN5O/c1-21-8-11(6-18-21)15(23)19-14-13(16)9-22(20-14)7-10-2-4-12(17)5-3-10/h2-6,8-9H,7H2,1H3,(H,19,20,23) |
| InChIKey | JFMSFOUBLNAYET-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |