C17H19BrFN3O — CID 19392684
N-[4-bromo-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]cyclohexanecarboxamide (PubChem CID 19392684) has the molecular formula C17H19BrFN3O and a molecular weight of 380.26 g/mol. Its IUPAC name is N-[4-bromo-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[4-bromo-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 19392684 |
| Molecular Formula | C17H19BrFN3O |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | N-[4-bromo-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1nn(Cc2ccc(F)cc2)cc1Br)C1CCCCC1 |
| InChI | InChI=1S/C17H19BrFN3O/c18-15-11-22(10-12-6-8-14(19)9-7-12)21-16(15)20-17(23)13-4-2-1-3-5-13/h6-9,11,13H,1-5,10H2,(H,20,21,23) |
| InChIKey | MKSDRLWSUKAYGX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |