C12H24OS — CID 19349494
2,5-dibutyl-1,4-oxathiane (PubChem CID 19349494) has the molecular formula C12H24OS and a molecular weight of 216.39 g/mol. Its IUPAC name is 2,5-dibutyl-1,4-oxathiane.
| Compound Name | 2,5-dibutyl-1,4-oxathiane |
|---|---|
| PubChem CID | 19349494 |
| Molecular Formula | C12H24OS |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2,5-dibutyl-1,4-oxathiane |
| SMILES | CCCCC1CSC(CCCC)CO1 |
| InChI | InChI=1S/C12H24OS/c1-3-5-7-11-10-14-12(9-13-11)8-6-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | RXKNWZPQKWLGFN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |